C26H27F3N4O6S2 — CID 143974138
N-[3-[(2S,7R)-6-hydroxy-4-oxo-3-[(2,3,4-trifluorophenyl)methyl]-3-azatricyclo[6.2.2.02,7]dodecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide (PubChem CID 143974138) has the molecular formula C26H27F3N4O6S2 and a molecular weight of 612.65 g/mol. Its IUPAC name is N-[3-[(2S,7R)-6-hydroxy-4-oxo-3-[(2,3,4-trifluorophenyl)methyl]-3-azatricyclo[6.2.2.02,7]dodecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-[(2S,7R)-6-hydroxy-4-oxo-3-[(2,3,4-trifluorophenyl)methyl]-3-azatricyclo[6.2.2.02,7]dodecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 143974138 |
| Molecular Formula | C26H27F3N4O6S2 |
| Molecular Weight | 612.65 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | N-[3-[(2S,7R)-6-hydroxy-4-oxo-3-[(2,3,4-trifluorophenyl)methyl]-3-azatricyclo[6.2.2.02,7]dodecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)S(=O)(=O)N=C(C1C(=O)N(Cc3ccc(F)c(F)c3F)[C@H]3C4CCC(CC4)[C@H]3C1O)N2 |
| InChI | InChI=1S/C26H27F3N4O6S2/c1-40(36,37)31-15-7-9-17-18(10-15)41(38,39)32-25(30-17)20-24(34)19-12-2-4-13(5-3-12)23(19)33(26(20)35)11-14-6-8-16(27)22(29)21(14)28/h6-10,12-13,19-20,23-24,31,34H,2-5,11H2,1H3,(H,30,32)/t12?,13?,19-,20?,23+,24?/m1/s1 |
| InChIKey | GERIFHSUSKSTLT-BWOLJOFISA-N |
| XLogP | 2.81 |
| TPSA | 145.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.65 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|