C26H18NO2- — CID 143976208
[4-[[3-[(1,3-dioxoinden-2-ylidene)methyl]-1H-inden-1-yl]methyl]phenyl]azanide (PubChem CID 143976208) has the molecular formula C26H18NO2- and a molecular weight of 376.44 g/mol. Its IUPAC name is [4-[[3-[(1,3-dioxoinden-2-ylidene)methyl]-1H-inden-1-yl]methyl]phenyl]azanide.
| Compound Name | [4-[[3-[(1,3-dioxoinden-2-ylidene)methyl]-1H-inden-1-yl]methyl]phenyl]azanide |
|---|---|
| PubChem CID | 143976208 |
| Molecular Formula | C26H18NO2- |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | [4-[[3-[(1,3-dioxoinden-2-ylidene)methyl]-1H-inden-1-yl]methyl]phenyl]azanide |
| SMILES | [NH-]c1ccc(CC2C=C(C=C3C(=O)c4ccccc4C3=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H18NO2/c27-19-11-9-16(10-12-19)13-17-14-18(21-6-2-1-5-20(17)21)15-24-25(28)22-7-3-4-8-23(22)26(24)29/h1-12,14-15,17,27H,13H2/q-1 |
| InChIKey | XGBPYOHTMNXDBS-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 57.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|