C26H19NO2 — CID 143976209
2-[[3-[(4-aminophenyl)methyl]-3H-inden-1-yl]methylidene]indene-1,3-dione (PubChem CID 143976209) has the molecular formula C26H19NO2 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-[[3-[(4-aminophenyl)methyl]-3H-inden-1-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[3-[(4-aminophenyl)methyl]-3H-inden-1-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 143976209 |
| Molecular Formula | C26H19NO2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-[[3-[(4-aminophenyl)methyl]-3H-inden-1-yl]methylidene]indene-1,3-dione |
| SMILES | Nc1ccc(CC2C=C(C=C3C(=O)c4ccccc4C3=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H19NO2/c27-19-11-9-16(10-12-19)13-17-14-18(21-6-2-1-5-20(17)21)15-24-25(28)22-7-3-4-8-23(22)26(24)29/h1-12,14-15,17H,13,27H2 |
| InChIKey | RDCYGAOEMQRQDI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|