C20H22ClN3O4S — CID 143981528
(4Z)-4-[4-[(Z)-3-amino-2-aminosulfanyl-3-(4-chlorophenyl)prop-2-enoxy]phenyl]-4-methoxyiminobutanoic acid (PubChem CID 143981528) has the molecular formula C20H22ClN3O4S and a molecular weight of 435.93 g/mol. Its IUPAC name is (4Z)-4-[4-[(Z)-3-amino-2-aminosulfanyl-3-(4-chlorophenyl)prop-2-enoxy]phenyl]-4-methoxyiminobutanoic acid.
| Compound Name | (4Z)-4-[4-[(Z)-3-amino-2-aminosulfanyl-3-(4-chlorophenyl)prop-2-enoxy]phenyl]-4-methoxyiminobutanoic acid |
|---|---|
| PubChem CID | 143981528 |
| Molecular Formula | C20H22ClN3O4S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | (4Z)-4-[4-[(Z)-3-amino-2-aminosulfanyl-3-(4-chlorophenyl)prop-2-enoxy]phenyl]-4-methoxyiminobutanoic acid |
| SMILES | CO/N=C(/CCC(=O)O)c1ccc(OC/C(SN)=C(/N)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H22ClN3O4S/c1-27-24-17(10-11-19(25)26)13-4-8-16(9-5-13)28-12-18(29-23)20(22)14-2-6-15(21)7-3-14/h2-9H,10-12,22-23H2,1H3,(H,25,26)/b20-18-,24-17- |
| InChIKey | KMCZCXDOHWMXDT-CPLMDLMSSA-N |
| XLogP | 3.87 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|