C22H27Cl2N3O4S — CID 143985173
4-benzyl-8-(3,5-dichloro-4-hydroxyphenyl)sulfonyl-1,4,8-triazaspiro[4.5]decan-3-one;ethane (PubChem CID 143985173) has the molecular formula C22H27Cl2N3O4S and a molecular weight of 500.45 g/mol. Its IUPAC name is 4-benzyl-8-(3,5-dichloro-4-hydroxyphenyl)sulfonyl-1,4,8-triazaspiro[4.5]decan-3-one;ethane.
| Compound Name | 4-benzyl-8-(3,5-dichloro-4-hydroxyphenyl)sulfonyl-1,4,8-triazaspiro[4.5]decan-3-one;ethane |
|---|---|
| PubChem CID | 143985173 |
| Molecular Formula | C22H27Cl2N3O4S |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 4-benzyl-8-(3,5-dichloro-4-hydroxyphenyl)sulfonyl-1,4,8-triazaspiro[4.5]decan-3-one;ethane |
| SMILES | CC.O=C1CNC2(CCN(S(=O)(=O)c3cc(Cl)c(O)c(Cl)c3)CC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H21Cl2N3O4S.C2H6/c21-16-10-15(11-17(22)19(16)27)30(28,29)24-8-6-20(7-9-24)23-12-18(26)25(20)13-14-4-2-1-3-5-14;1-2/h1-5,10-11,23,27H,6-9,12-13H2;1-2H3 |
| InChIKey | UJIIQLSZIZYXMC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |