C31H31N3O4S — CID 143985182
N-(4-phenylphenyl)-N-[8-(4-phenylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-4-yl]hydroxylamine (PubChem CID 143985182) has the molecular formula C31H31N3O4S and a molecular weight of 541.67 g/mol. Its IUPAC name is N-(4-phenylphenyl)-N-[8-(4-phenylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-4-yl]hydroxylamine.
| Compound Name | N-(4-phenylphenyl)-N-[8-(4-phenylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-4-yl]hydroxylamine |
|---|---|
| PubChem CID | 143985182 |
| Molecular Formula | C31H31N3O4S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | N-(4-phenylphenyl)-N-[8-(4-phenylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-4-yl]hydroxylamine |
| SMILES | O=S(=O)(c1ccc(-c2ccccc2)cc1)N1CCC2(CC1)OCCN2N(O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H31N3O4S/c35-34(29-15-11-27(12-16-29)25-7-3-1-4-8-25)33-23-24-38-31(33)19-21-32(22-20-31)39(36,37)30-17-13-28(14-18-30)26-9-5-2-6-10-26/h1-18,35H,19-24H2 |
| InChIKey | JIZBAWRRYNVEBB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|