C34H50F2N2O2 — CID 143987157
(5aR,11aR)-10-cyano-N-(2,2-difluoroethyl)-1,5a,5b,8,8,11a-hexamethyl-9-oxo-2,3,4,5,6,7,7a,11b,12,13,13a,13b-dodecahydro-1H-cyclopenta[a]chrysene-3a-carboxamide;prop-1-ene (PubChem CID 143987157) has the molecular formula C34H50F2N2O2 and a molecular weight of 556.78 g/mol. Its IUPAC name is (5aR,11aR)-10-cyano-N-(2,2-difluoroethyl)-1,5a,5b,8,8,11a-hexamethyl-9-oxo-2,3,4,5,6,7,7a,11b,12,13,13a,13b-dodecahydro-1H-cyclopenta[a]chrysene-3a-carboxamide;prop-1-ene.
| Compound Name | (5aR,11aR)-10-cyano-N-(2,2-difluoroethyl)-1,5a,5b,8,8,11a-hexamethyl-9-oxo-2,3,4,5,6,7,7a,11b,12,13,13a,13b-dodecahydro-1H-cyclopenta[a]chrysene-3a-carboxamide;prop-1-ene |
|---|---|
| PubChem CID | 143987157 |
| Molecular Formula | C34H50F2N2O2 |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 556.38 |
| IUPAC Name | (5aR,11aR)-10-cyano-N-(2,2-difluoroethyl)-1,5a,5b,8,8,11a-hexamethyl-9-oxo-2,3,4,5,6,7,7a,11b,12,13,13a,13b-dodecahydro-1H-cyclopenta[a]chrysene-3a-carboxamide;prop-1-ene |
| SMILES | C=CC.CC1CCC2(C(=O)NCC(F)F)CC[C@]3(C)C(CCC4C3(C)CCC3C(C)(C)C(=O)C(C#N)=C[C@@]34C)C12 |
| InChI | InChI=1S/C31H44F2N2O2.C3H6/c1-18-9-12-31(26(37)35-17-23(32)33)14-13-29(5)20(24(18)31)7-8-22-28(4)15-19(16-34)25(36)27(2,3)21(28)10-11-30(22,29)6;1-3-2/h15,18,20-24H,7-14,17H2,1-6H3,(H,35,37);3H,1H2,2H3/t18?,20?,21?,22?,24?,28-,29+,30?,31?;/m0./s1 |
| InChIKey | KEBSDOKZYDEWES-DCXKFEBTSA-N |
| XLogP | 7.90 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|