C36H45N5O2S2 — CID 143999093
3-[[4-[1-(3-amino-3,3-diphenylpropyl)sulfanylethenyl]piperazin-1-yl]sulfanylmethoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one;ethane (PubChem CID 143999093) has the molecular formula C36H45N5O2S2 and a molecular weight of 643.92 g/mol. Its IUPAC name is 3-[[4-[1-(3-amino-3,3-diphenylpropyl)sulfanylethenyl]piperazin-1-yl]sulfanylmethoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one;ethane.
| Compound Name | 3-[[4-[1-(3-amino-3,3-diphenylpropyl)sulfanylethenyl]piperazin-1-yl]sulfanylmethoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one;ethane |
|---|---|
| PubChem CID | 143999093 |
| Molecular Formula | C36H45N5O2S2 |
| Molecular Weight | 643.92 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | 3-[[4-[1-(3-amino-3,3-diphenylpropyl)sulfanylethenyl]piperazin-1-yl]sulfanylmethoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one;ethane |
| SMILES | C=C(SCCC(N)(c1ccccc1)c1ccccc1)N1CCN(SCOc2ccc3c(c2)N=CC2CCCN2C3=O)CC1.CC |
| InChI | InChI=1S/C34H39N5O2S2.C2H6/c1-26(42-22-16-34(35,27-9-4-2-5-10-27)28-11-6-3-7-12-28)37-18-20-38(21-19-37)43-25-41-30-14-15-31-32(23-30)36-24-29-13-8-17-39(29)33(31)40;1-2/h2-7,9-12,14-15,23-24,29H,1,8,13,16-22,25,35H2;1-2H3 |
| InChIKey | MPMBJWPUWFPWLT-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 74.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.92 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|