C12H10F4O2 — CID 14423029
[4-(but-3-yn-2-yloxymethyl)-2,3,5,6-tetrafluorophenyl]methanol (PubChem CID 14423029) has the molecular formula C12H10F4O2 and a molecular weight of 262.20 g/mol. Its IUPAC name is [4-(but-3-yn-2-yloxymethyl)-2,3,5,6-tetrafluorophenyl]methanol.
| Compound Name | [4-(but-3-yn-2-yloxymethyl)-2,3,5,6-tetrafluorophenyl]methanol |
|---|---|
| PubChem CID | 14423029 |
| Molecular Formula | C12H10F4O2 |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | [4-(but-3-yn-2-yloxymethyl)-2,3,5,6-tetrafluorophenyl]methanol |
| SMILES | C#CC(C)OCc1c(F)c(F)c(CO)c(F)c1F |
| InChI | InChI=1S/C12H10F4O2/c1-3-6(2)18-5-8-11(15)9(13)7(4-17)10(14)12(8)16/h1,6,17H,4-5H2,2H3 |
| InChIKey | WSMDUGMNNWKYCJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|