C18H30O3SSi — CID 14433572
[3-(benzenesulfonyl)cyclohexyl]oxy-tert-butyl-dimethylsilane (PubChem CID 14433572) has the molecular formula C18H30O3SSi and a molecular weight of 354.59 g/mol. Its IUPAC name is [3-(benzenesulfonyl)cyclohexyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [3-(benzenesulfonyl)cyclohexyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 14433572 |
| Molecular Formula | C18H30O3SSi |
| Molecular Weight | 354.59 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [3-(benzenesulfonyl)cyclohexyl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCC(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C18H30O3SSi/c1-18(2,3)23(4,5)21-15-10-9-13-17(14-15)22(19,20)16-11-7-6-8-12-16/h6-8,11-12,15,17H,9-10,13-14H2,1-5H3 |
| InChIKey | SIYLNRSHDLUGLG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|