C12H11F13O2 — CID 14433678
8-(2-ethenoxyethoxy)-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorooctane (PubChem CID 14433678) has the molecular formula C12H11F13O2 and a molecular weight of 434.19 g/mol. Its IUPAC name is 8-(2-ethenoxyethoxy)-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorooctane.
| Compound Name | 8-(2-ethenoxyethoxy)-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorooctane |
|---|---|
| PubChem CID | 14433678 |
| Molecular Formula | C12H11F13O2 |
| Molecular Weight | 434.19 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 8-(2-ethenoxyethoxy)-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorooctane |
| SMILES | C=COCCOCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F13O2/c1-2-26-5-6-27-4-3-7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h2H,1,3-6H2 |
| InChIKey | DPUTXZZQMBBOAM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.19 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|