C11H16ClN — CID 144503750
(3E,4Z)-2-chloro-3,4-di(ethylidene)pyridine;ethane (PubChem CID 144503750) has the molecular formula C11H16ClN and a molecular weight of 197.71 g/mol. Its IUPAC name is (3E,4Z)-2-chloro-3,4-di(ethylidene)pyridine;ethane.
| Compound Name | (3E,4Z)-2-chloro-3,4-di(ethylidene)pyridine;ethane |
|---|---|
| PubChem CID | 144503750 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (3E,4Z)-2-chloro-3,4-di(ethylidene)pyridine;ethane |
| SMILES | C/C=c1/ccnc(Cl)/c1=C/C.CC |
| InChI | InChI=1S/C9H10ClN.C2H6/c1-3-7-5-6-11-9(10)8(7)4-2;1-2/h3-6H,1-2H3;1-2H3/b7-3-,8-4+; |
| InChIKey | NVZRAJVGGSYGAZ-ONANWKRQSA-N |
| XLogP | 2.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|