C26H28F3N7O3 — CID 144510274
8-amino-N-(3-methoxypropyl)-3-methyl-1-[4-[[N-methyl-C-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]carbonimidoyl]carbamoyl]phenyl]imidazo[1,5-a]pyrazine-5-carboxamide (PubChem CID 144510274) has the molecular formula C26H28F3N7O3 and a molecular weight of 543.55 g/mol. Its IUPAC name is 8-amino-N-(3-methoxypropyl)-3-methyl-1-[4-[[N-methyl-C-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]carbonimidoyl]carbamoyl]phenyl]imidazo[1,5-a]pyrazine-5-carboxamide.
| Compound Name | 8-amino-N-(3-methoxypropyl)-3-methyl-1-[4-[[N-methyl-C-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]carbonimidoyl]carbamoyl]phenyl]imidazo[1,5-a]pyrazine-5-carboxamide |
|---|---|
| PubChem CID | 144510274 |
| Molecular Formula | C26H28F3N7O3 |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 8-amino-N-(3-methoxypropyl)-3-methyl-1-[4-[[N-methyl-C-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]carbonimidoyl]carbamoyl]phenyl]imidazo[1,5-a]pyrazine-5-carboxamide |
| SMILES | C=C/C(=C\C(=N/C)NC(=O)c1ccc(-c2nc(C)n3c(C(=O)NCCCOC)cnc(N)c23)cc1)C(F)(F)F |
| InChI | InChI=1S/C26H28F3N7O3/c1-5-18(26(27,28)29)13-20(31-3)35-24(37)17-9-7-16(8-10-17)21-22-23(30)33-14-19(36(22)15(2)34-21)25(38)32-11-6-12-39-4/h5,7-10,13-14H,1,6,11-12H2,2-4H3,(H2,30,33)(H,32,38)(H,31,35,37)/b18-13+ |
| InChIKey | GUAJGTIBPNSYPX-QGOAFFKASA-N |
| XLogP | 3.49 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|