C12H21FN2O — CID 144516889
(E)-N-[(1S,2R)-2-aminocyclopentyl]-2-fluorohept-2-enamide (PubChem CID 144516889) has the molecular formula C12H21FN2O and a molecular weight of 228.31 g/mol. Its IUPAC name is (E)-N-[(1S,2R)-2-aminocyclopentyl]-2-fluorohept-2-enamide.
| Compound Name | (E)-N-[(1S,2R)-2-aminocyclopentyl]-2-fluorohept-2-enamide |
|---|---|
| PubChem CID | 144516889 |
| Molecular Formula | C12H21FN2O |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (E)-N-[(1S,2R)-2-aminocyclopentyl]-2-fluorohept-2-enamide |
| SMILES | CCCC/C=C(/F)C(=O)N[C@H]1CCC[C@H]1N |
| InChI | InChI=1S/C12H21FN2O/c1-2-3-4-6-9(13)12(16)15-11-8-5-7-10(11)14/h6,10-11H,2-5,7-8,14H2,1H3,(H,15,16)/b9-6+/t10-,11+/m1/s1 |
| InChIKey | ZITPSJVWMSCZBQ-FSZCPTMNSA-N |
| XLogP | 2.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|