C21H35N — CID 144530858
2,4-dimethyl-N-[(2Z,4Z)-3-methyl-5-phenylpenta-2,4-dienyl]pentan-1-amine;ethane (PubChem CID 144530858) has the molecular formula C21H35N and a molecular weight of 301.52 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(2Z,4Z)-3-methyl-5-phenylpenta-2,4-dienyl]pentan-1-amine;ethane.
| Compound Name | 2,4-dimethyl-N-[(2Z,4Z)-3-methyl-5-phenylpenta-2,4-dienyl]pentan-1-amine;ethane |
|---|---|
| PubChem CID | 144530858 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | 2,4-dimethyl-N-[(2Z,4Z)-3-methyl-5-phenylpenta-2,4-dienyl]pentan-1-amine;ethane |
| SMILES | CC.CC(/C=C\c1ccccc1)=C/CNCC(C)CC(C)C |
| InChI | InChI=1S/C19H29N.C2H6/c1-16(2)14-18(4)15-20-13-12-17(3)10-11-19-8-6-5-7-9-19;1-2/h5-12,16,18,20H,13-15H2,1-4H3;1-2H3/b11-10-,17-12-; |
| InChIKey | FDMOZCQYBARMTK-AKNUIGCDSA-N |
| XLogP | 5.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|