C19H29N — CID 144530859
2,4-dimethyl-N-[(2Z,4Z)-3-methyl-5-phenylpenta-2,4-dienyl]pentan-1-amine (PubChem CID 144530859) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(2Z,4Z)-3-methyl-5-phenylpenta-2,4-dienyl]pentan-1-amine.
| Compound Name | 2,4-dimethyl-N-[(2Z,4Z)-3-methyl-5-phenylpenta-2,4-dienyl]pentan-1-amine |
|---|---|
| PubChem CID | 144530859 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 2,4-dimethyl-N-[(2Z,4Z)-3-methyl-5-phenylpenta-2,4-dienyl]pentan-1-amine |
| SMILES | CC(/C=C\c1ccccc1)=C/CNCC(C)CC(C)C |
| InChI | InChI=1S/C19H29N/c1-16(2)14-18(4)15-20-13-12-17(3)10-11-19-8-6-5-7-9-19/h5-12,16,18,20H,13-15H2,1-4H3/b11-10-,17-12- |
| InChIKey | OJSNHTRLOUPGAD-VVDIUWRXSA-N |
| XLogP | 4.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|