C11H20BrN — CID 144534702
(3E)-5-bromo-N,N,2-trimethylhexa-1,3,5-trien-3-amine;ethane (PubChem CID 144534702) has the molecular formula C11H20BrN and a molecular weight of 246.19 g/mol. Its IUPAC name is (3E)-5-bromo-N,N,2-trimethylhexa-1,3,5-trien-3-amine;ethane.
| Compound Name | (3E)-5-bromo-N,N,2-trimethylhexa-1,3,5-trien-3-amine;ethane |
|---|---|
| PubChem CID | 144534702 |
| Molecular Formula | C11H20BrN |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | (3E)-5-bromo-N,N,2-trimethylhexa-1,3,5-trien-3-amine;ethane |
| SMILES | C=C(Br)/C=C(\C(=C)C)N(C)C.CC |
| InChI | InChI=1S/C9H14BrN.C2H6/c1-7(2)9(11(4)5)6-8(3)10;1-2/h6H,1,3H2,2,4-5H3;1-2H3/b9-6+; |
| InChIKey | LTEAPFOCYVSTMT-MLBSPLJJSA-N |
| XLogP | 3.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|