C8H8F3NO2 — CID 144535425
2-(hydroxyamino)-1-(2,4,5-trifluorophenyl)ethanol (PubChem CID 144535425) has the molecular formula C8H8F3NO2 and a molecular weight of 207.15 g/mol. Its IUPAC name is 2-(hydroxyamino)-1-(2,4,5-trifluorophenyl)ethanol.
| Compound Name | 2-(hydroxyamino)-1-(2,4,5-trifluorophenyl)ethanol |
|---|---|
| PubChem CID | 144535425 |
| Molecular Formula | C8H8F3NO2 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 2-(hydroxyamino)-1-(2,4,5-trifluorophenyl)ethanol |
| SMILES | ONCC(O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C8H8F3NO2/c9-5-2-7(11)6(10)1-4(5)8(13)3-12-14/h1-2,8,12-14H,3H2 |
| InChIKey | FAHSBPJJUGHVLV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|