C16H22N2O3 — CID 144537986
1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazine;3,4-dihydroisochromen-1-one (PubChem CID 144537986) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazine;3,4-dihydroisochromen-1-one.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazine;3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 144537986 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazine;3,4-dihydroisochromen-1-one |
| SMILES | C1CN2CCOCC2CN1.O=C1OCCc2ccccc21 |
| InChI | InChI=1S/C9H8O2.C7H14N2O/c10-9-8-4-2-1-3-7(8)5-6-11-9;1-2-9-3-4-10-6-7(9)5-8-1/h1-4H,5-6H2;7-8H,1-6H2 |
| InChIKey | VJBSILKOVQMPRR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |