C20H32N2O6 — CID 144539962
1-[4-[2-[2-(3,3-dimethyl-2-oxobutoxy)ethoxy]ethylamino]-4-methyl-3-oxopentyl]pyrrole-2,5-dione (PubChem CID 144539962) has the molecular formula C20H32N2O6 and a molecular weight of 396.48 g/mol. Its IUPAC name is 1-[4-[2-[2-(3,3-dimethyl-2-oxobutoxy)ethoxy]ethylamino]-4-methyl-3-oxopentyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[2-[2-(3,3-dimethyl-2-oxobutoxy)ethoxy]ethylamino]-4-methyl-3-oxopentyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 144539962 |
| Molecular Formula | C20H32N2O6 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 1-[4-[2-[2-(3,3-dimethyl-2-oxobutoxy)ethoxy]ethylamino]-4-methyl-3-oxopentyl]pyrrole-2,5-dione |
| SMILES | CC(C)(C)C(=O)COCCOCCNC(C)(C)C(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H32N2O6/c1-19(2,3)16(24)14-28-13-12-27-11-9-21-20(4,5)15(23)8-10-22-17(25)6-7-18(22)26/h6-7,21H,8-14H2,1-5H3 |
| InChIKey | GHEYMYURCKXUQB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|