C19H38N2O7S — CID 90147296
6-[2-[2-(3,3-dimethyl-2-oxobutoxy)ethoxy]ethylamino]-6-methyl-2-(methylamino)-5-oxoheptane-1-sulfonic acid (PubChem CID 90147296) has the molecular formula C19H38N2O7S and a molecular weight of 438.59 g/mol. Its IUPAC name is 6-[2-[2-(3,3-dimethyl-2-oxobutoxy)ethoxy]ethylamino]-6-methyl-2-(methylamino)-5-oxoheptane-1-sulfonic acid.
| Compound Name | 6-[2-[2-(3,3-dimethyl-2-oxobutoxy)ethoxy]ethylamino]-6-methyl-2-(methylamino)-5-oxoheptane-1-sulfonic acid |
|---|---|
| PubChem CID | 90147296 |
| Molecular Formula | C19H38N2O7S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 6-[2-[2-(3,3-dimethyl-2-oxobutoxy)ethoxy]ethylamino]-6-methyl-2-(methylamino)-5-oxoheptane-1-sulfonic acid |
| SMILES | CNC(CCC(=O)C(C)(C)NCCOCCOCC(=O)C(C)(C)C)CS(=O)(=O)O |
| InChI | InChI=1S/C19H38N2O7S/c1-18(2,3)17(23)13-28-12-11-27-10-9-21-19(4,5)16(22)8-7-15(20-6)14-29(24,25)26/h15,20-21H,7-14H2,1-6H3,(H,24,25,26) |
| InChIKey | JNSHPSHTTFRYCS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|