C22H25ClN4O4 — CID 144549733
tert-butyl N-[4-[5-[(1E,3S)-3-acetamidopenta-1,4-dienyl]pyrimidin-2-yl]oxy-3-chlorophenyl]carbamate (PubChem CID 144549733) has the molecular formula C22H25ClN4O4 and a molecular weight of 444.92 g/mol. Its IUPAC name is tert-butyl N-[4-[5-[(1E,3S)-3-acetamidopenta-1,4-dienyl]pyrimidin-2-yl]oxy-3-chlorophenyl]carbamate.
| Compound Name | tert-butyl N-[4-[5-[(1E,3S)-3-acetamidopenta-1,4-dienyl]pyrimidin-2-yl]oxy-3-chlorophenyl]carbamate |
|---|---|
| PubChem CID | 144549733 |
| Molecular Formula | C22H25ClN4O4 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | tert-butyl N-[4-[5-[(1E,3S)-3-acetamidopenta-1,4-dienyl]pyrimidin-2-yl]oxy-3-chlorophenyl]carbamate |
| SMILES | C=C[C@@H](/C=C/c1cnc(Oc2ccc(NC(=O)OC(C)(C)C)cc2Cl)nc1)NC(C)=O |
| InChI | InChI=1S/C22H25ClN4O4/c1-6-16(26-14(2)28)8-7-15-12-24-20(25-13-15)30-19-10-9-17(11-18(19)23)27-21(29)31-22(3,4)5/h6-13,16H,1H2,2-5H3,(H,26,28)(H,27,29)/b8-7+/t16-/m0/s1 |
| InChIKey | QDTYGERVYNLRLS-WAVCKPEOSA-N |
| XLogP | 4.97 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|