C23H36O2 — CID 144561415
[(3E,5E,7Z,9Z)-6,8-dimethylundeca-1,3,5,7,9-pentaen-3-yl] 4,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 144561415) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is [(3E,5E,7Z,9Z)-6,8-dimethylundeca-1,3,5,7,9-pentaen-3-yl] 4,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | [(3E,5E,7Z,9Z)-6,8-dimethylundeca-1,3,5,7,9-pentaen-3-yl] 4,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 144561415 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | [(3E,5E,7Z,9Z)-6,8-dimethylundeca-1,3,5,7,9-pentaen-3-yl] 4,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | C=C/C(=C\C=C(C)\C=C(C)/C=C\C)OC(=O)C(CC(C)(C)C)C(C)C |
| InChI | InChI=1S/C23H36O2/c1-10-12-18(5)15-19(6)13-14-20(11-2)25-22(24)21(17(3)4)16-23(7,8)9/h10-15,17,21H,2,16H2,1,3-9H3/b12-10-,18-15-,19-13+,20-14+ |
| InChIKey | PVBARSHUHGSRDM-FUCSEVFOSA-N |
| XLogP | 6.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|