C29H34F3NO2 — CID 144562859
2-butoxy-5-[3-[[(3Z,5Z)-5-cyclopropyl-4-ethylhepta-1,3,5-trien-2-yl]oxymethyl]-4-fluorophenyl]-4-(difluoromethyl)pyridine (PubChem CID 144562859) has the molecular formula C29H34F3NO2 and a molecular weight of 485.59 g/mol. Its IUPAC name is 2-butoxy-5-[3-[[(3Z,5Z)-5-cyclopropyl-4-ethylhepta-1,3,5-trien-2-yl]oxymethyl]-4-fluorophenyl]-4-(difluoromethyl)pyridine.
| Compound Name | 2-butoxy-5-[3-[[(3Z,5Z)-5-cyclopropyl-4-ethylhepta-1,3,5-trien-2-yl]oxymethyl]-4-fluorophenyl]-4-(difluoromethyl)pyridine |
|---|---|
| PubChem CID | 144562859 |
| Molecular Formula | C29H34F3NO2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 2-butoxy-5-[3-[[(3Z,5Z)-5-cyclopropyl-4-ethylhepta-1,3,5-trien-2-yl]oxymethyl]-4-fluorophenyl]-4-(difluoromethyl)pyridine |
| SMILES | C=C(/C=C(CC)\C(=C/C)C1CC1)OCc1cc(-c2cnc(OCCCC)cc2C(F)F)ccc1F |
| InChI | InChI=1S/C29H34F3NO2/c1-5-8-13-34-28-16-25(29(31)32)26(17-33-28)22-11-12-27(30)23(15-22)18-35-19(4)14-20(6-2)24(7-3)21-9-10-21/h7,11-12,14-17,21,29H,4-6,8-10,13,18H2,1-3H3/b20-14-,24-7+ |
| InChIKey | JZQOXVHDPMLUIP-PQMWWBQKSA-N |
| XLogP | 8.73 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|