C32H39FN8O3 — CID 144566224
5-(2-fluoro-4-phenoxybenzenecarboximidoyl)-4-N-methylpyrimidine-4,6-diamine;(E)-4-(2-methoxyethylamino)-4-methyl-2-(pyrrolidine-1-carbonyl)pent-2-enenitrile (PubChem CID 144566224) has the molecular formula C32H39FN8O3 and a molecular weight of 602.72 g/mol. Its IUPAC name is 5-(2-fluoro-4-phenoxybenzenecarboximidoyl)-4-N-methylpyrimidine-4,6-diamine;(E)-4-(2-methoxyethylamino)-4-methyl-2-(pyrrolidine-1-carbonyl)pent-2-enenitrile.
| Compound Name | 5-(2-fluoro-4-phenoxybenzenecarboximidoyl)-4-N-methylpyrimidine-4,6-diamine;(E)-4-(2-methoxyethylamino)-4-methyl-2-(pyrrolidine-1-carbonyl)pent-2-enenitrile |
|---|---|
| PubChem CID | 144566224 |
| Molecular Formula | C32H39FN8O3 |
| Molecular Weight | 602.72 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | 5-(2-fluoro-4-phenoxybenzenecarboximidoyl)-4-N-methylpyrimidine-4,6-diamine;(E)-4-(2-methoxyethylamino)-4-methyl-2-(pyrrolidine-1-carbonyl)pent-2-enenitrile |
| SMILES | COCCNC(C)(C)/C=C(\C#N)C(=O)N1CCCC1.[H]/N=C(\c1ccc(Oc2ccccc2)cc1F)c1c(N)ncnc1NC |
| InChI | InChI=1S/C18H16FN5O.C14H23N3O2/c1-22-18-15(17(21)23-10-24-18)16(20)13-8-7-12(9-14(13)19)25-11-5-3-2-4-6-11;1-14(2,16-6-9-19-3)10-12(11-15)13(18)17-7-4-5-8-17/h2-10,20H,1H3,(H3,21,22,23,24);10,16H,4-9H2,1-3H3/b20-16+;12-10+ |
| InChIKey | FIIXHZQMDSMILI-BETLWGHJSA-N |
| XLogP | 4.52 |
| TPSA | 162.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.72 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|