C31H51N — CID 144566282
(2Z,4E,6E,8E,10Z)-9-tert-butyl-N-ethyl-2-[(Z,2E)-2-ethylidene-5,6-dimethylhept-3-enylidene]-N,3-dimethyldodeca-4,6,8,10-tetraen-1-amine (PubChem CID 144566282) has the molecular formula C31H51N and a molecular weight of 437.76 g/mol. Its IUPAC name is (2Z,4E,6E,8E,10Z)-9-tert-butyl-N-ethyl-2-[(Z,2E)-2-ethylidene-5,6-dimethylhept-3-enylidene]-N,3-dimethyldodeca-4,6,8,10-tetraen-1-amine.
| Compound Name | (2Z,4E,6E,8E,10Z)-9-tert-butyl-N-ethyl-2-[(Z,2E)-2-ethylidene-5,6-dimethylhept-3-enylidene]-N,3-dimethyldodeca-4,6,8,10-tetraen-1-amine |
|---|---|
| PubChem CID | 144566282 |
| Molecular Formula | C31H51N |
| Molecular Weight | 437.76 g/mol |
| Exact Mass | 437.40 |
| IUPAC Name | (2Z,4E,6E,8E,10Z)-9-tert-butyl-N-ethyl-2-[(Z,2E)-2-ethylidene-5,6-dimethylhept-3-enylidene]-N,3-dimethyldodeca-4,6,8,10-tetraen-1-amine |
| SMILES | C/C=C\C(=C/C=C/C=C/C(C)/C(=C/C(/C=C\C(C)C(C)C)=C/C)CN(C)CC)C(C)(C)C |
| InChI | InChI=1S/C31H51N/c1-12-18-30(31(8,9)10)20-17-15-16-19-27(7)29(24-32(11)14-3)23-28(13-2)22-21-26(6)25(4)5/h12-13,15-23,25-27H,14,24H2,1-11H3/b17-15+,18-12-,19-16+,22-21-,28-13+,29-23+,30-20+ |
| InChIKey | JWSYKLVIHFODQJ-HWGGBOPJSA-N |
| XLogP | 8.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.76 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|