C22H29FO2S — CID 144573136
(3S)-3-fluoro-2-methyl-5-[(4-methylphenyl)methoxymethyl]thiolane;(4-methylphenyl)methanol (PubChem CID 144573136) has the molecular formula C22H29FO2S and a molecular weight of 376.54 g/mol. Its IUPAC name is (3S)-3-fluoro-2-methyl-5-[(4-methylphenyl)methoxymethyl]thiolane;(4-methylphenyl)methanol.
| Compound Name | (3S)-3-fluoro-2-methyl-5-[(4-methylphenyl)methoxymethyl]thiolane;(4-methylphenyl)methanol |
|---|---|
| PubChem CID | 144573136 |
| Molecular Formula | C22H29FO2S |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (3S)-3-fluoro-2-methyl-5-[(4-methylphenyl)methoxymethyl]thiolane;(4-methylphenyl)methanol |
| SMILES | Cc1ccc(CO)cc1.Cc1ccc(COCC2C[C@H](F)C(C)S2)cc1 |
| InChI | InChI=1S/C14H19FOS.C8H10O/c1-10-3-5-12(6-4-10)8-16-9-13-7-14(15)11(2)17-13;1-7-2-4-8(6-9)5-3-7/h3-6,11,13-14H,7-9H2,1-2H3;2-5,9H,6H2,1H3/t11?,13?,14-;/m0./s1 |
| InChIKey | XVIDYDPSDWPPEX-JOOYLYHMSA-N |
| XLogP | 5.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |