About 2-bromo-5-[(4-chlorophenyl)methoxymethyl]-3-fluorothiolane;(4-chlorophenyl)methanol
2-bromo-5-[(4-chlorophenyl)methoxymethyl]-3-fluorothiolane;(4-chlorophenyl)methanol (PubChem CID 144573183) has the molecular formula C19H20BrCl2FO2S
and a molecular weight of 482.24 g/mol. Its IUPAC name is 2-bromo-5-[(4-chlorophenyl)methoxymethyl]-3-fluorothiolane;(4-chlorophenyl)methanol.
Molecular Properties
| Compound Name | 2-bromo-5-[(4-chlorophenyl)methoxymethyl]-3-fluorothiolane;(4-chlorophenyl)methanol |
| PubChem CID | 144573183 |
| Molecular Formula | C19H20BrCl2FO2S |
| Molecular Weight | 482.24 g/mol |
| Exact Mass | 479.97 |
| IUPAC Name | 2-bromo-5-[(4-chlorophenyl)methoxymethyl]-3-fluorothiolane;(4-chlorophenyl)methanol |
| SMILES | FC1CC(COCc2ccc(Cl)cc2)SC1Br.OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13BrClFOS.C7H7ClO/c13-12-11(15)5-10(17-12)7-16-6-8-1-3-9(14)4-2-8;8-7-3-1-6(5-9)2-4-7/h1-4,10-12H,5-7H2;1-4,9H,5H2 |
| InChIKey | JVPBOCQHORCESK-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.24 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-[(4-chlorophenyl)methoxymethyl]-3-fluorothiolane;(4-chlorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-[(4-chlorophenyl)methoxymethyl]-3-fluorothiolane;(4-chlorophenyl)methanol?
The IUPAC name of 2-bromo-5-[(4-chlorophenyl)methoxymethyl]-3-fluorothiolane;(4-chlorophenyl)methanol (CID 144573183) is 2-bromo-5-[(4-chlorophenyl)methoxymethyl]-3-fluorothiolane;(4-chlorophenyl)methanol.
What is the SMILES notation for 2-bromo-5-[(4-chlorophenyl)methoxymethyl]-3-fluorothiolane;(4-chlorophenyl)methanol?
The canonical SMILES for 2-bromo-5-[(4-chlorophenyl)methoxymethyl]-3-fluorothiolane;(4-chlorophenyl)methanol is FC1CC(COCc2ccc(Cl)cc2)SC1Br.OCc1ccc(Cl)cc1.
What is the InChIKey of 2-bromo-5-[(4-chlorophenyl)methoxymethyl]-3-fluorothiolane;(4-chlorophenyl)methanol?
The InChIKey is JVPBOCQHORCESK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrClFOS.C7H7ClO/c13-12-11(15)5-10(17-12)7-16-6-8-1-3-9(14)4-2-8;8-7-3-1-6(5-9)2-4-7/h1-4,10-12H,5-7H2;1-4,9H,5H2.
What are the key properties of 2-bromo-5-[(4-chlorophenyl)methoxymethyl]-3-fluorothiolane;(4-chlorophenyl)methanol?
2-bromo-5-[(4-chlorophenyl)methoxymethyl]-3-fluorothiolane;(4-chlorophenyl)methanol has a molecular weight of 482.24 g/mol, XLogP of 6.25, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-[(4-chlorophenyl)methoxymethyl]-3-fluorothiolane;(4-chlorophenyl)methanol is sourced from PubChem (CID 144573183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).