C7H16N2O4 — CID 144581107
(3R,6R)-2-methyl-6-(methylaminooxy)piperidine-3,4,5-triol (PubChem CID 144581107) has the molecular formula C7H16N2O4 and a molecular weight of 192.22 g/mol. Its IUPAC name is (3R,6R)-2-methyl-6-(methylaminooxy)piperidine-3,4,5-triol.
| Compound Name | (3R,6R)-2-methyl-6-(methylaminooxy)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 144581107 |
| Molecular Formula | C7H16N2O4 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | (3R,6R)-2-methyl-6-(methylaminooxy)piperidine-3,4,5-triol |
| SMILES | CNO[C@H]1NC(C)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C7H16N2O4/c1-3-4(10)5(11)6(12)7(9-3)13-8-2/h3-12H,1-2H3/t3?,4-,5?,6?,7-/m1/s1 |
| InChIKey | HUHQPNYXWPUXCV-XFQYLJLSSA-N |
| XLogP | -2.46 |
| TPSA | 93.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|