C15H21N2O3P — CID 144591667
5-ethyl-3-(4-morpholin-4-yl-3-phosphanylphenyl)-1,3-oxazolidin-2-one (PubChem CID 144591667) has the molecular formula C15H21N2O3P and a molecular weight of 308.32 g/mol. Its IUPAC name is 5-ethyl-3-(4-morpholin-4-yl-3-phosphanylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-ethyl-3-(4-morpholin-4-yl-3-phosphanylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 144591667 |
| Molecular Formula | C15H21N2O3P |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 5-ethyl-3-(4-morpholin-4-yl-3-phosphanylphenyl)-1,3-oxazolidin-2-one |
| SMILES | CCC1CN(c2ccc(N3CCOCC3)c(P)c2)C(=O)O1 |
| InChI | InChI=1S/C15H21N2O3P/c1-2-12-10-17(15(18)20-12)11-3-4-13(14(21)9-11)16-5-7-19-8-6-16/h3-4,9,12H,2,5-8,10,21H2,1H3 |
| InChIKey | OLNRBOOWOOPQRJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|