C14H17N5O3 — CID 14459472
3-(3-nitro-4-piperazin-1-ylphenyl)-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 14459472) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is 3-(3-nitro-4-piperazin-1-ylphenyl)-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-(3-nitro-4-piperazin-1-ylphenyl)-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 14459472 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 3-(3-nitro-4-piperazin-1-ylphenyl)-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | O=C1CCC(c2ccc(N3CCNCC3)c([N+](=O)[O-])c2)=NN1 |
| InChI | InChI=1S/C14H17N5O3/c20-14-4-2-11(16-17-14)10-1-3-12(13(9-10)19(21)22)18-7-5-15-6-8-18/h1,3,9,15H,2,4-8H2,(H,17,20) |
| InChIKey | SJDUCSHAXHNOFO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|