C18H24N6O4S — CID 22158031
methyl N'-[1-[4-[4-(hydroxymethyl)-6-oxo-4,5-dihydro-1H-pyridazin-3-yl]-2-nitrophenyl]piperidin-4-yl]carbamimidothioate (PubChem CID 22158031) has the molecular formula C18H24N6O4S and a molecular weight of 420.50 g/mol. Its IUPAC name is methyl N'-[1-[4-[4-(hydroxymethyl)-6-oxo-4,5-dihydro-1H-pyridazin-3-yl]-2-nitrophenyl]piperidin-4-yl]carbamimidothioate.
| Compound Name | methyl N'-[1-[4-[4-(hydroxymethyl)-6-oxo-4,5-dihydro-1H-pyridazin-3-yl]-2-nitrophenyl]piperidin-4-yl]carbamimidothioate |
|---|---|
| PubChem CID | 22158031 |
| Molecular Formula | C18H24N6O4S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | methyl N'-[1-[4-[4-(hydroxymethyl)-6-oxo-4,5-dihydro-1H-pyridazin-3-yl]-2-nitrophenyl]piperidin-4-yl]carbamimidothioate |
| SMILES | CS/C(N)=N\C1CCN(c2ccc(C3=NNC(=O)CC3CO)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H24N6O4S/c1-29-18(19)20-13-4-6-23(7-5-13)14-3-2-11(8-15(14)24(27)28)17-12(10-25)9-16(26)21-22-17/h2-3,8,12-13,25H,4-7,9-10H2,1H3,(H2,19,20)(H,21,26) |
| InChIKey | DOSLBBDPGIGHRA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 146.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|