C16H19N6O4+ — CID 22157992
4-(hydroxymethyl)-3-[4-[4-(iminomethylidene)piperazin-4-ium-1-yl]-3-nitrophenyl]-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 22157992) has the molecular formula C16H19N6O4+ and a molecular weight of 359.37 g/mol. Its IUPAC name is 4-(hydroxymethyl)-3-[4-[4-(iminomethylidene)piperazin-4-ium-1-yl]-3-nitrophenyl]-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 4-(hydroxymethyl)-3-[4-[4-(iminomethylidene)piperazin-4-ium-1-yl]-3-nitrophenyl]-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 22157992 |
| Molecular Formula | C16H19N6O4+ |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 4-(hydroxymethyl)-3-[4-[4-(iminomethylidene)piperazin-4-ium-1-yl]-3-nitrophenyl]-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | N=C=[N+]1CCN(c2ccc(C3=NNC(=O)CC3CO)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H18N6O4/c17-10-20-3-5-21(6-4-20)13-2-1-11(7-14(13)22(25)26)16-12(9-23)8-15(24)18-19-16/h1-2,7,12,17,23H,3-6,8-9H2/p+1 |
| InChIKey | RSGCNOKFVICKFG-UHFFFAOYSA-O |
| XLogP | 0.01 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|