C22H28N2O2 — CID 144600709
N-methyl-6-(2-phenylmethoxyspiro[3.5]nonan-7-yl)oxypyridin-3-amine (PubChem CID 144600709) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-methyl-6-(2-phenylmethoxyspiro[3.5]nonan-7-yl)oxypyridin-3-amine.
| Compound Name | N-methyl-6-(2-phenylmethoxyspiro[3.5]nonan-7-yl)oxypyridin-3-amine |
|---|---|
| PubChem CID | 144600709 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-methyl-6-(2-phenylmethoxyspiro[3.5]nonan-7-yl)oxypyridin-3-amine |
| SMILES | CNc1ccc(OC2CCC3(CC2)CC(OCc2ccccc2)C3)nc1 |
| InChI | InChI=1S/C22H28N2O2/c1-23-18-7-8-21(24-15-18)26-19-9-11-22(12-10-19)13-20(14-22)25-16-17-5-3-2-4-6-17/h2-8,15,19-20,23H,9-14,16H2,1H3 |
| InChIKey | GGYLEAXVHMEDHE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |