C17H15F3N4O2 — CID 144601862
4-[[(Z)-2,3-bis(methylideneamino)prop-2-enyl]amino]-1-[4-(trifluoromethoxy)phenyl]pyridin-2-one (PubChem CID 144601862) has the molecular formula C17H15F3N4O2 and a molecular weight of 364.33 g/mol. Its IUPAC name is 4-[[(Z)-2,3-bis(methylideneamino)prop-2-enyl]amino]-1-[4-(trifluoromethoxy)phenyl]pyridin-2-one.
| Compound Name | 4-[[(Z)-2,3-bis(methylideneamino)prop-2-enyl]amino]-1-[4-(trifluoromethoxy)phenyl]pyridin-2-one |
|---|---|
| PubChem CID | 144601862 |
| Molecular Formula | C17H15F3N4O2 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 4-[[(Z)-2,3-bis(methylideneamino)prop-2-enyl]amino]-1-[4-(trifluoromethoxy)phenyl]pyridin-2-one |
| SMILES | C=N/C=C(/CNc1ccn(-c2ccc(OC(F)(F)F)cc2)c(=O)c1)N=C |
| InChI | InChI=1S/C17H15F3N4O2/c1-21-10-13(22-2)11-23-12-7-8-24(16(25)9-12)14-3-5-15(6-4-14)26-17(18,19)20/h3-10,23H,1-2,11H2/b13-10- |
| InChIKey | DHNMOVWRFLDZIJ-RAXLEYEMSA-N |
| XLogP | 3.39 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|