C23H33F3N4O2 — CID 145096191
ethane;(E)-3-(methylideneamino)-2-[(Z)-[5-[4-(trifluoromethoxy)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyliminomethyl]prop-2-enal (PubChem CID 145096191) has the molecular formula C23H33F3N4O2 and a molecular weight of 454.54 g/mol. Its IUPAC name is ethane;(E)-3-(methylideneamino)-2-[(Z)-[5-[4-(trifluoromethoxy)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyliminomethyl]prop-2-enal.
| Compound Name | ethane;(E)-3-(methylideneamino)-2-[(Z)-[5-[4-(trifluoromethoxy)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyliminomethyl]prop-2-enal |
|---|---|
| PubChem CID | 145096191 |
| Molecular Formula | C23H33F3N4O2 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | ethane;(E)-3-(methylideneamino)-2-[(Z)-[5-[4-(trifluoromethoxy)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyliminomethyl]prop-2-enal |
| SMILES | C=N/C=C(C=O)\C=N/CN1CC2CN(c3ccc(OC(F)(F)F)cc3)CC2C1.CC.CC |
| InChI | InChI=1S/C19H21F3N4O2.2C2H6/c1-23-6-14(12-27)7-24-13-25-8-15-10-26(11-16(15)9-25)17-2-4-18(5-3-17)28-19(20,21)22;2*1-2/h2-7,12,15-16H,1,8-11,13H2;2*1-2H3/b14-6+,24-7-;; |
| InChIKey | HAHLIEJJAREKEQ-POQSVWLZSA-N |
| XLogP | 4.82 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|