C8H16N2 — CID 144605969
(1Z,3E)-3-N-methylhepta-1,3-diene-1,3-diamine (PubChem CID 144605969) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is (1Z,3E)-3-N-methylhepta-1,3-diene-1,3-diamine.
| Compound Name | (1Z,3E)-3-N-methylhepta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 144605969 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (1Z,3E)-3-N-methylhepta-1,3-diene-1,3-diamine |
| SMILES | CCC/C=C(\C=C/N)NC |
| InChI | InChI=1S/C8H16N2/c1-3-4-5-8(10-2)6-7-9/h5-7,10H,3-4,9H2,1-2H3/b7-6-,8-5+ |
| InChIKey | IIHUIWQSPOYJMW-WNXMRAAYSA-N |
| XLogP | 1.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|