C21H35F2N3O — CID 144608203
1,4-difluorobenzene;ethane;2-[5-(methylamino)oxan-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 144608203) has the molecular formula C21H35F2N3O and a molecular weight of 383.53 g/mol. Its IUPAC name is 1,4-difluorobenzene;ethane;2-[5-(methylamino)oxan-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | 1,4-difluorobenzene;ethane;2-[5-(methylamino)oxan-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 144608203 |
| Molecular Formula | C21H35F2N3O |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | 1,4-difluorobenzene;ethane;2-[5-(methylamino)oxan-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | CC.CNC1COCC(N2CC3CC(N)CC3C2)C1.Fc1ccc(F)cc1 |
| InChI | InChI=1S/C13H25N3O.C6H4F2.C2H6/c1-15-12-4-13(8-17-7-12)16-5-9-2-11(14)3-10(9)6-16;7-5-1-2-6(8)4-3-5;1-2/h9-13,15H,2-8,14H2,1H3;1-4H;1-2H3 |
| InChIKey | RHUYIPQJPQBKNL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |