C27H40N4O — CID 144615400
3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)hept-6-enamide (PubChem CID 144615400) has the molecular formula C27H40N4O and a molecular weight of 436.64 g/mol. Its IUPAC name is 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)hept-6-enamide.
| Compound Name | 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)hept-6-enamide |
|---|---|
| PubChem CID | 144615400 |
| Molecular Formula | C27H40N4O |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)hept-6-enamide |
| SMILES | C=CCCC(CC(=O)Nc1ccc(C)cc1C)c1nnc(CCCC(C)(C)C)n1C1CC1 |
| InChI | InChI=1S/C27H40N4O/c1-7-8-10-21(18-25(32)28-23-15-12-19(2)17-20(23)3)26-30-29-24(31(26)22-13-14-22)11-9-16-27(4,5)6/h7,12,15,17,21-22H,1,8-11,13-14,16,18H2,2-6H3,(H,28,32) |
| InChIKey | LXQNDOXBIGEBIX-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|