C27H39N3O — CID 160590161
(4R)-4-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-1-(2,4-dimethylphenyl)hept-6-en-2-one (PubChem CID 160590161) has the molecular formula C27H39N3O and a molecular weight of 421.63 g/mol. Its IUPAC name is (4R)-4-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-1-(2,4-dimethylphenyl)hept-6-en-2-one.
| Compound Name | (4R)-4-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-1-(2,4-dimethylphenyl)hept-6-en-2-one |
|---|---|
| PubChem CID | 160590161 |
| Molecular Formula | C27H39N3O |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.31 |
| IUPAC Name | (4R)-4-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-1-(2,4-dimethylphenyl)hept-6-en-2-one |
| SMILES | C=CC[C@H](CC(=O)Cc1ccc(C)cc1C)c1nnc(CCCC(C)(C)C)n1C1CC1 |
| InChI | InChI=1S/C27H39N3O/c1-7-9-22(18-24(31)17-21-12-11-19(2)16-20(21)3)26-29-28-25(30(26)23-13-14-23)10-8-15-27(4,5)6/h7,11-12,16,22-23H,1,8-10,13-15,17-18H2,2-6H3/t22-/m1/s1 |
| InChIKey | RCXGDWDSBZBSDM-JOCHJYFZSA-N |
| XLogP | 6.46 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|