C27H39N5O2 — CID 121345932
(2S,3S)-2-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)-1-methyl-6-oxopiperidine-3-carboxamide (PubChem CID 121345932) has the molecular formula C27H39N5O2 and a molecular weight of 465.64 g/mol. Its IUPAC name is (2S,3S)-2-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)-1-methyl-6-oxopiperidine-3-carboxamide.
| Compound Name | (2S,3S)-2-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)-1-methyl-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 121345932 |
| Molecular Formula | C27H39N5O2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.31 |
| IUPAC Name | (2S,3S)-2-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)-1-methyl-6-oxopiperidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2CCC(=O)N(C)[C@@H]2c2nnc(CCCC(C)(C)C)n2C2CC2)c(C)c1 |
| InChI | InChI=1S/C27H39N5O2/c1-17-9-13-21(18(2)16-17)28-26(34)20-12-14-23(33)31(6)24(20)25-30-29-22(32(25)19-10-11-19)8-7-15-27(3,4)5/h9,13,16,19-20,24H,7-8,10-12,14-15H2,1-6H3,(H,28,34)/t20-,24-/m0/s1 |
| InChIKey | COCNCCKKPMKJRG-RDPSFJRHSA-N |
| XLogP | 5.15 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |