C31H47N5O3 — CID 121345789
tert-butyl (3R,4S)-4-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-3-[(2,4-dimethylphenyl)carbamoyl]piperidine-1-carboxylate (PubChem CID 121345789) has the molecular formula C31H47N5O3 and a molecular weight of 537.75 g/mol. Its IUPAC name is tert-butyl (3R,4S)-4-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-3-[(2,4-dimethylphenyl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-4-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-3-[(2,4-dimethylphenyl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 121345789 |
| Molecular Formula | C31H47N5O3 |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.37 |
| IUPAC Name | tert-butyl (3R,4S)-4-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-3-[(2,4-dimethylphenyl)carbamoyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)[C@H]2CN(C(=O)OC(C)(C)C)CC[C@@H]2c2nnc(CCCC(C)(C)C)n2C2CC2)c(C)c1 |
| InChI | InChI=1S/C31H47N5O3/c1-20-11-14-25(21(2)18-20)32-28(37)24-19-35(29(38)39-31(6,7)8)17-15-23(24)27-34-33-26(36(27)22-12-13-22)10-9-16-30(3,4)5/h11,14,18,22-24H,9-10,12-13,15-17,19H2,1-8H3,(H,32,37)/t23-,24-/m0/s1 |
| InChIKey | KZVCHLKHPRAAPG-ZEQRLZLVSA-N |
| XLogP | 6.58 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |