C26H36F3N5O2 — CID 121346240
(3S,4S)-1-acetyl-4-[5-(4,4-dimethylpentyl)-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)pyrrolidine-3-carboxamide (PubChem CID 121346240) has the molecular formula C26H36F3N5O2 and a molecular weight of 507.60 g/mol. Its IUPAC name is (3S,4S)-1-acetyl-4-[5-(4,4-dimethylpentyl)-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-1-acetyl-4-[5-(4,4-dimethylpentyl)-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 121346240 |
| Molecular Formula | C26H36F3N5O2 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | (3S,4S)-1-acetyl-4-[5-(4,4-dimethylpentyl)-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)pyrrolidine-3-carboxamide |
| SMILES | CC(=O)N1C[C@@H](C(=O)Nc2ccc(C)cc2C)[C@H](c2nnc(CCCC(C)(C)C)n2CC(F)(F)F)C1 |
| InChI | InChI=1S/C26H36F3N5O2/c1-16-9-10-21(17(2)12-16)30-24(36)20-14-33(18(3)35)13-19(20)23-32-31-22(8-7-11-25(4,5)6)34(23)15-26(27,28)29/h9-10,12,19-20H,7-8,11,13-15H2,1-6H3,(H,30,36)/t19-,20-/m1/s1 |
| InChIKey | LQQXPHHVDADDJZ-WOJBJXKFSA-N |
| XLogP | 5.03 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |