C18H21N3O2 — CID 144616466
(3R,7S)-2,3,7-trimethyl-6-(4-methylphenyl)-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carbonitrile (PubChem CID 144616466) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is (3R,7S)-2,3,7-trimethyl-6-(4-methylphenyl)-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carbonitrile.
| Compound Name | (3R,7S)-2,3,7-trimethyl-6-(4-methylphenyl)-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carbonitrile |
|---|---|
| PubChem CID | 144616466 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (3R,7S)-2,3,7-trimethyl-6-(4-methylphenyl)-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carbonitrile |
| SMILES | Cc1ccc(C2N3C(=O)[C@@H](C)N(C)C(=O)C3C[C@]2(C)C#N)cc1 |
| InChI | InChI=1S/C18H21N3O2/c1-11-5-7-13(8-6-11)15-18(3,10-19)9-14-17(23)20(4)12(2)16(22)21(14)15/h5-8,12,14-15H,9H2,1-4H3/t12-,14?,15?,18-/m1/s1 |
| InChIKey | RGWYUVXSGQKTNP-UZFJHYNOSA-N |
| XLogP | 2.03 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |