C26H23N3OS2 — CID 144621094
2-isoquinolin-1-yl-4-[1-[4-(1,3,4-oxathiazinan-4-yl)phenyl]ethenylamino]benzenethiol (PubChem CID 144621094) has the molecular formula C26H23N3OS2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 2-isoquinolin-1-yl-4-[1-[4-(1,3,4-oxathiazinan-4-yl)phenyl]ethenylamino]benzenethiol.
| Compound Name | 2-isoquinolin-1-yl-4-[1-[4-(1,3,4-oxathiazinan-4-yl)phenyl]ethenylamino]benzenethiol |
|---|---|
| PubChem CID | 144621094 |
| Molecular Formula | C26H23N3OS2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2-isoquinolin-1-yl-4-[1-[4-(1,3,4-oxathiazinan-4-yl)phenyl]ethenylamino]benzenethiol |
| SMILES | C=C(Nc1ccc(S)c(-c2nccc3ccccc23)c1)c1ccc(N2CCOCS2)cc1 |
| InChI | InChI=1S/C26H23N3OS2/c1-18(19-6-9-22(10-7-19)29-14-15-30-17-32-29)28-21-8-11-25(31)24(16-21)26-23-5-3-2-4-20(23)12-13-27-26/h2-13,16,28,31H,1,14-15,17H2 |
| InChIKey | YGDWUFJVFBXSNM-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|