C11H17N3O3 — CID 144635125
(2S)-2-cyclohexyl-2-(2,3-diiminopropanoylamino)acetic acid (PubChem CID 144635125) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-2-(2,3-diiminopropanoylamino)acetic acid.
| Compound Name | (2S)-2-cyclohexyl-2-(2,3-diiminopropanoylamino)acetic acid |
|---|---|
| PubChem CID | 144635125 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (2S)-2-cyclohexyl-2-(2,3-diiminopropanoylamino)acetic acid |
| SMILES | [H]/N=C/C(=N\[H])C(=O)N[C@H](C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C11H17N3O3/c12-6-8(13)10(15)14-9(11(16)17)7-4-2-1-3-5-7/h6-7,9,12-13H,1-5H2,(H,14,15)(H,16,17)/b12-6+,13-8+/t9-/m0/s1 |
| InChIKey | YYGXSBCMXPFYNB-FNKXOENTSA-N |
| XLogP | 0.81 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|