C5H4N2S3 — CID 144642949
3-aminothieno[2,3-c][1,2]thiazole-5-thiol (PubChem CID 144642949) has the molecular formula C5H4N2S3 and a molecular weight of 188.30 g/mol. Its IUPAC name is 3-aminothieno[2,3-c][1,2]thiazole-5-thiol.
| Compound Name | 3-aminothieno[2,3-c][1,2]thiazole-5-thiol |
|---|---|
| PubChem CID | 144642949 |
| Molecular Formula | C5H4N2S3 |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 187.95 |
| IUPAC Name | 3-aminothieno[2,3-c][1,2]thiazole-5-thiol |
| SMILES | Nc1snc2sc(S)cc12 |
| InChI | InChI=1S/C5H4N2S3/c6-4-2-1-3(8)9-5(2)7-10-4/h1,8H,6H2 |
| InChIKey | QOAUECTWHZQDQA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|