C7H14N2O — CID 144648206
4,5-dimethyl-1,3-diazepan-2-one (PubChem CID 144648206) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-diazepan-2-one.
| Compound Name | 4,5-dimethyl-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 144648206 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 4,5-dimethyl-1,3-diazepan-2-one |
| SMILES | CC1CCNC(=O)NC1C |
| InChI | InChI=1S/C7H14N2O/c1-5-3-4-8-7(10)9-6(5)2/h5-6H,3-4H2,1-2H3,(H2,8,9,10) |
| InChIKey | UBHHQMCQEFDMCJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |