C23H31F2NO2S — CID 144649599
8a-(2,4-difluorophenyl)-2-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazine;methane;(3Z)-2-(methoxymethyl)hexa-1,3,5-triene (PubChem CID 144649599) has the molecular formula C23H31F2NO2S and a molecular weight of 423.57 g/mol. Its IUPAC name is 8a-(2,4-difluorophenyl)-2-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazine;methane;(3Z)-2-(methoxymethyl)hexa-1,3,5-triene.
| Compound Name | 8a-(2,4-difluorophenyl)-2-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazine;methane;(3Z)-2-(methoxymethyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 144649599 |
| Molecular Formula | C23H31F2NO2S |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 8a-(2,4-difluorophenyl)-2-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazine;methane;(3Z)-2-(methoxymethyl)hexa-1,3,5-triene |
| SMILES | C.C=C/C=C\C(=C)COC.CC1=NC2(c3ccc(F)cc3F)COCCC2CS1 |
| InChI | InChI=1S/C14H15F2NOS.C8H12O.CH4/c1-9-17-14(8-18-5-4-10(14)7-19-9)12-3-2-11(15)6-13(12)16;1-4-5-6-8(2)7-9-3;/h2-3,6,10H,4-5,7-8H2,1H3;4-6H,1-2,7H2,3H3;1H4/b;6-5-; |
| InChIKey | YCMDVUMLEIHAST-XRPAZMCKSA-N |
| XLogP | 5.93 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|