About N-amino-N-methylformamide;2-(bromomethyl)-3-fluoro-N-methylaniline
N-amino-N-methylformamide;2-(bromomethyl)-3-fluoro-N-methylaniline (PubChem CID 144659656) has the molecular formula C10H15BrFN3O
and a molecular weight of 292.15 g/mol. Its IUPAC name is N-amino-N-methylformamide;2-(bromomethyl)-3-fluoro-N-methylaniline.
Molecular Properties
| Compound Name | N-amino-N-methylformamide;2-(bromomethyl)-3-fluoro-N-methylaniline |
| PubChem CID | 144659656 |
| Molecular Formula | C10H15BrFN3O |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | N-amino-N-methylformamide;2-(bromomethyl)-3-fluoro-N-methylaniline |
| SMILES | CN(N)C=O.CNc1cccc(F)c1CBr |
| InChI | InChI=1S/C8H9BrFN.C2H6N2O/c1-11-8-4-2-3-7(10)6(8)5-9;1-4(3)2-5/h2-4,11H,5H2,1H3;2H,3H2,1H3 |
| InChIKey | FAHRDBVXTQUXBP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N-methylformamide;2-(bromomethyl)-3-fluoro-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N-methylformamide;2-(bromomethyl)-3-fluoro-N-methylaniline?
The IUPAC name of N-amino-N-methylformamide;2-(bromomethyl)-3-fluoro-N-methylaniline (CID 144659656) is N-amino-N-methylformamide;2-(bromomethyl)-3-fluoro-N-methylaniline.
What is the SMILES notation for N-amino-N-methylformamide;2-(bromomethyl)-3-fluoro-N-methylaniline?
The canonical SMILES for N-amino-N-methylformamide;2-(bromomethyl)-3-fluoro-N-methylaniline is CN(N)C=O.CNc1cccc(F)c1CBr.
What is the InChIKey of N-amino-N-methylformamide;2-(bromomethyl)-3-fluoro-N-methylaniline?
The InChIKey is FAHRDBVXTQUXBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrFN.C2H6N2O/c1-11-8-4-2-3-7(10)6(8)5-9;1-4(3)2-5/h2-4,11H,5H2,1H3;2H,3H2,1H3.
What are the key properties of N-amino-N-methylformamide;2-(bromomethyl)-3-fluoro-N-methylaniline?
N-amino-N-methylformamide;2-(bromomethyl)-3-fluoro-N-methylaniline has a molecular weight of 292.15 g/mol, XLogP of 1.71, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N-methylformamide;2-(bromomethyl)-3-fluoro-N-methylaniline is sourced from PubChem (CID 144659656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).